C20H31ClN2O3 — CID 171625197
tert-butyl (2S)-4-[(5-chloro-2-propoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 171625197) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is tert-butyl (2S)-4-[(5-chloro-2-propoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[(5-chloro-2-propoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171625197 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl (2S)-4-[(5-chloro-2-propoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCCOc1ccc(Cl)cc1CN1CCN(C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C20H31ClN2O3/c1-6-11-25-18-8-7-17(21)12-16(18)14-22-9-10-23(15(2)13-22)19(24)26-20(3,4)5/h7-8,12,15H,6,9-11,13-14H2,1-5H3/t15-/m0/s1 |
| InChIKey | KDTWPISTWCKZLT-HNNXBMFYSA-N |
| XLogP | 4.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |