C19H29ClN2O3 — CID 171625154
tert-butyl N-[[(3R)-1-[(5-chloro-2-ethoxyphenyl)methyl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 171625154) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-[(5-chloro-2-ethoxyphenyl)methyl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-[(5-chloro-2-ethoxyphenyl)methyl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171625154 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl N-[[(3R)-1-[(5-chloro-2-ethoxyphenyl)methyl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CCOc1ccc(Cl)cc1CN1CC[C@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29ClN2O3/c1-5-24-17-7-6-16(20)10-15(17)13-22-9-8-14(12-22)11-21-18(23)25-19(2,3)4/h6-7,10,14H,5,8-9,11-13H2,1-4H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | RYHIPZJVNBVCDM-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |