C20H29ClIN2O3- — CID 177027688
tert-butyl N-[(3R)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]iodanuidylcarbamate (PubChem CID 177027688) has the molecular formula C20H29ClIN2O3- and a molecular weight of 507.82 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]iodanuidylcarbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]iodanuidylcarbamate |
|---|---|
| PubChem CID | 177027688 |
| Molecular Formula | C20H29ClIN2O3- |
| Molecular Weight | 507.82 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]iodanuidylcarbamate |
| SMILES | CC(C)(C)OC(=O)N[I-][C@@H]1CCN(Cc2cc(Cl)ccc2OCC2CC2)C1 |
| InChI | InChI=1S/C20H29ClIN2O3/c1-20(2,3)27-19(25)23-22-17-8-9-24(12-17)11-15-10-16(21)6-7-18(15)26-13-14-4-5-14/h6-7,10,14,17H,4-5,8-9,11-13H2,1-3H3,(H,23,25)/q-1/t17-/m1/s1 |
| InChIKey | UNHGUKDVCGTRTH-QGZVFWFLSA-N |
| XLogP | 1.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.82 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|