C16H24ClN2O+ — CID 177027719
[(3S)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]methylazanium (PubChem CID 177027719) has the molecular formula C16H24ClN2O+ and a molecular weight of 295.83 g/mol. Its IUPAC name is [(3S)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]methylazanium.
| Compound Name | [(3S)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]methylazanium |
|---|---|
| PubChem CID | 177027719 |
| Molecular Formula | C16H24ClN2O+ |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [(3S)-1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]pyrrolidin-3-yl]methylazanium |
| SMILES | [NH3+]C[C@@H]1CCN(Cc2cc(Cl)ccc2OCC2CC2)C1 |
| InChI | InChI=1S/C16H23ClN2O/c17-15-3-4-16(20-11-12-1-2-12)14(7-15)10-19-6-5-13(8-18)9-19/h3-4,7,12-13H,1-2,5-6,8-11,18H2/p+1/t13-/m0/s1 |
| InChIKey | PYHXUQIZGHJRFK-ZDUSSCGKSA-O |
| XLogP | 2.19 |
| TPSA | 40.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |