C17H28ClNO — CID 143666320
4-[(4-chloro-2-ethylphenoxy)methyl]-1-methylpiperidine;ethane (PubChem CID 143666320) has the molecular formula C17H28ClNO and a molecular weight of 297.87 g/mol. Its IUPAC name is 4-[(4-chloro-2-ethylphenoxy)methyl]-1-methylpiperidine;ethane.
| Compound Name | 4-[(4-chloro-2-ethylphenoxy)methyl]-1-methylpiperidine;ethane |
|---|---|
| PubChem CID | 143666320 |
| Molecular Formula | C17H28ClNO |
| Molecular Weight | 297.87 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-[(4-chloro-2-ethylphenoxy)methyl]-1-methylpiperidine;ethane |
| SMILES | CC.CCc1cc(Cl)ccc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C15H22ClNO.C2H6/c1-3-13-10-14(16)4-5-15(13)18-11-12-6-8-17(2)9-7-12;1-2/h4-5,10,12H,3,6-9,11H2,1-2H3;1-2H3 |
| InChIKey | WGGIZKBVXFENBH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |