C14H21Cl2NO — CID 56830862
4-[(4-chloro-2-ethylphenoxy)methyl]piperidine;hydrochloride (PubChem CID 56830862) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-[(4-chloro-2-ethylphenoxy)methyl]piperidine;hydrochloride.
| Compound Name | 4-[(4-chloro-2-ethylphenoxy)methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 56830862 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-[(4-chloro-2-ethylphenoxy)methyl]piperidine;hydrochloride |
| SMILES | CCc1cc(Cl)ccc1OCC1CCNCC1.Cl |
| InChI | InChI=1S/C14H20ClNO.ClH/c1-2-12-9-13(15)3-4-14(12)17-10-11-5-7-16-8-6-11;/h3-4,9,11,16H,2,5-8,10H2,1H3;1H |
| InChIKey | HTGMHNZZWUBEGF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |