C18H31ClN2O — CID 171625215
[1-[(2-butoxy-5-chlorophenyl)methyl]pyrrolidin-3-yl]methanamine;ethane (PubChem CID 171625215) has the molecular formula C18H31ClN2O and a molecular weight of 326.91 g/mol. Its IUPAC name is [1-[(2-butoxy-5-chlorophenyl)methyl]pyrrolidin-3-yl]methanamine;ethane.
| Compound Name | [1-[(2-butoxy-5-chlorophenyl)methyl]pyrrolidin-3-yl]methanamine;ethane |
|---|---|
| PubChem CID | 171625215 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | [1-[(2-butoxy-5-chlorophenyl)methyl]pyrrolidin-3-yl]methanamine;ethane |
| SMILES | CC.CCCCOc1ccc(Cl)cc1CN1CCC(CN)C1 |
| InChI | InChI=1S/C16H25ClN2O.C2H6/c1-2-3-8-20-16-5-4-15(17)9-14(16)12-19-7-6-13(10-18)11-19;1-2/h4-5,9,13H,2-3,6-8,10-12,18H2,1H3;1-2H3 |
| InChIKey | IFZBAAWYLOXEHB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|