C14H22Cl2N2O2 — CID 171625171
[(2S)-4-[(5-chloro-2-ethoxyphenyl)methyl]morpholin-2-yl]methanamine;hydrochloride (PubChem CID 171625171) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is [(2S)-4-[(5-chloro-2-ethoxyphenyl)methyl]morpholin-2-yl]methanamine;hydrochloride.
| Compound Name | [(2S)-4-[(5-chloro-2-ethoxyphenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171625171 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(2S)-4-[(5-chloro-2-ethoxyphenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
| SMILES | CCOc1ccc(Cl)cc1CN1CCO[C@@H](CN)C1.Cl |
| InChI | InChI=1S/C14H21ClN2O2.ClH/c1-2-18-14-4-3-12(15)7-11(14)9-17-5-6-19-13(8-16)10-17;/h3-4,7,13H,2,5-6,8-10,16H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | KMVJQWCYUFJMCK-ZOWNYOTGSA-N |
| XLogP | 2.32 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |