C23H41ClN2O3 — CID 177027714
tert-butyl formate;1-[1-[2-(5-chloro-2-ethoxyphenyl)ethyl]pyrrolidin-3-yl]-N-methylmethanamine;ethane (PubChem CID 177027714) has the molecular formula C23H41ClN2O3 and a molecular weight of 429.05 g/mol. Its IUPAC name is tert-butyl formate;1-[1-[2-(5-chloro-2-ethoxyphenyl)ethyl]pyrrolidin-3-yl]-N-methylmethanamine;ethane.
| Compound Name | tert-butyl formate;1-[1-[2-(5-chloro-2-ethoxyphenyl)ethyl]pyrrolidin-3-yl]-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 177027714 |
| Molecular Formula | C23H41ClN2O3 |
| Molecular Weight | 429.05 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | tert-butyl formate;1-[1-[2-(5-chloro-2-ethoxyphenyl)ethyl]pyrrolidin-3-yl]-N-methylmethanamine;ethane |
| SMILES | CC.CC(C)(C)OC=O.CCOc1ccc(Cl)cc1CCN1CCC(CNC)C1 |
| InChI | InChI=1S/C16H25ClN2O.C5H10O2.C2H6/c1-3-20-16-5-4-15(17)10-14(16)7-9-19-8-6-13(12-19)11-18-2;1-5(2,3)7-4-6;1-2/h4-5,10,13,18H,3,6-9,11-12H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | BWKZCIKWAZSFMM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.05 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|