C15H24BrOSi — CID 174483797
CID 174483797 (PubChem CID 174483797) has the molecular formula C15H24BrOSi and a molecular weight of 328.35 g/mol.
| Compound Name | CID 174483797 |
|---|---|
| PubChem CID | 174483797 |
| Molecular Formula | C15H24BrOSi |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)C(C)(C)COCCCc1ccccc1Br |
| InChI | InChI=1S/C15H24BrOSi/c1-15(2,18(3)4)12-17-11-7-9-13-8-5-6-10-14(13)16/h5-6,8,10H,7,9,11-12H2,1-4H3 |
| InChIKey | VGEXOKIZQDICAX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|