C28H40Br2O3 — CID 141331937
1-bromo-2-[5-[5-(2-bromophenyl)-1-methoxy-2,2-dimethylpentoxy]-5-methoxy-4,4-dimethylpentyl]benzene (PubChem CID 141331937) has the molecular formula C28H40Br2O3 and a molecular weight of 584.43 g/mol. Its IUPAC name is 1-bromo-2-[5-[5-(2-bromophenyl)-1-methoxy-2,2-dimethylpentoxy]-5-methoxy-4,4-dimethylpentyl]benzene.
| Compound Name | 1-bromo-2-[5-[5-(2-bromophenyl)-1-methoxy-2,2-dimethylpentoxy]-5-methoxy-4,4-dimethylpentyl]benzene |
|---|---|
| PubChem CID | 141331937 |
| Molecular Formula | C28H40Br2O3 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 1-bromo-2-[5-[5-(2-bromophenyl)-1-methoxy-2,2-dimethylpentoxy]-5-methoxy-4,4-dimethylpentyl]benzene |
| SMILES | COC(OC(OC)C(C)(C)CCCc1ccccc1Br)C(C)(C)CCCc1ccccc1Br |
| InChI | InChI=1S/C28H40Br2O3/c1-27(2,19-11-15-21-13-7-9-17-23(21)29)25(31-5)33-26(32-6)28(3,4)20-12-16-22-14-8-10-18-24(22)30/h7-10,13-14,17-18,25-26H,11-12,15-16,19-20H2,1-6H3 |
| InChIKey | XLRGLQUGORSYGZ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|