C18H26BrNO4 — CID 11003896
methyl (2S)-6-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 11003896) has the molecular formula C18H26BrNO4 and a molecular weight of 400.31 g/mol. Its IUPAC name is methyl (2S)-6-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 11003896 |
| Molecular Formula | C18H26BrNO4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl (2S)-6-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCc1ccccc1Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26BrNO4/c1-18(2,3)24-17(22)20-15(16(21)23-4)12-8-6-10-13-9-5-7-11-14(13)19/h5,7,9,11,15H,6,8,10,12H2,1-4H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | GSKACRFITYNKAZ-HNNXBMFYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|