C23H32N2O4 — CID 90216470
methyl (2S)-3-[4-(4-aminobutyl)naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 90216470) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl (2S)-3-[4-(4-aminobutyl)naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[4-(4-aminobutyl)naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 90216470 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl (2S)-3-[4-(4-aminobutyl)naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(CCCCN)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N2O4/c1-23(2,3)29-22(27)25-20(21(26)28-4)15-17-13-12-16(9-7-8-14-24)18-10-5-6-11-19(17)18/h5-6,10-13,20H,7-9,14-15,24H2,1-4H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | QXYGEKZIGUSHIQ-FQEVSTJZSA-N |
| XLogP | 3.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|