About CID 67791687
CID 67791687 (PubChem CID 67791687) has the molecular formula C12H18BrOSi
and a molecular weight of 286.26 g/mol.
Molecular Properties
| Compound Name | CID 67791687 |
| PubChem CID | 67791687 |
| Molecular Formula | C12H18BrOSi |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | — |
| SMILES | C[Si](C)C(C)(C)COc1ccccc1Br |
| InChI | InChI=1S/C12H18BrOSi/c1-12(2,15(3)4)9-14-11-8-6-5-7-10(11)13/h5-8H,9H2,1-4H3 |
| InChIKey | XOXRQNSIMVAQNP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67791687 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67791687?
The IUPAC name of CID 67791687 (CID 67791687) is not available.
What is the SMILES notation for CID 67791687?
The canonical SMILES for CID 67791687 is C[Si](C)C(C)(C)COc1ccccc1Br.
What is the InChIKey of CID 67791687?
The InChIKey is XOXRQNSIMVAQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrOSi/c1-12(2,15(3)4)9-14-11-8-6-5-7-10(11)13/h5-8H,9H2,1-4H3.
What are the key properties of CID 67791687?
CID 67791687 has a molecular weight of 286.26 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67791687 is sourced from PubChem (CID 67791687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).