C20H24Cl2N2O — CID 42764278
3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropyl-2,2-dimethylpropanamide (PubChem CID 42764278) has the molecular formula C20H24Cl2N2O and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropyl-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42764278 |
| Molecular Formula | C20H24Cl2N2O |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropyl-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)N(Cc1cccn1Cc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C20H24Cl2N2O/c1-20(2,14-21)19(25)24(16-9-10-16)13-17-7-5-11-23(17)12-15-6-3-4-8-18(15)22/h3-8,11,16H,9-10,12-14H2,1-2H3 |
| InChIKey | ZKSZAABMYPYBRG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|