C26H29ClN2O — CID 42764279
4-tert-butyl-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylbenzamide (PubChem CID 42764279) has the molecular formula C26H29ClN2O and a molecular weight of 420.98 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-tert-butyl-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 42764279 |
| Molecular Formula | C26H29ClN2O |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-tert-butyl-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(Cc2cccn2Cc2ccccc2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C26H29ClN2O/c1-26(2,3)21-12-10-19(11-13-21)25(30)29(22-14-15-22)18-23-8-6-16-28(23)17-20-7-4-5-9-24(20)27/h4-13,16,22H,14-15,17-18H2,1-3H3 |
| InChIKey | BCQUEDMFRIZBOO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |