C18H20Cl2N2O — CID 3980589
2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylpropanamide (PubChem CID 3980589) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylpropanamide.
| Compound Name | 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 3980589 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclopropylpropanamide |
| SMILES | CC(Cl)C(=O)N(Cc1cccn1Cc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-13(19)18(23)22(15-8-9-15)12-16-6-4-10-21(16)11-14-5-2-3-7-17(14)20/h2-7,10,13,15H,8-9,11-12H2,1H3 |
| InChIKey | XHZJIBAINDXGTL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|