C18H21Cl3N2O — CID 4020577
2,2-dichloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)acetamide (PubChem CID 4020577) has the molecular formula C18H21Cl3N2O and a molecular weight of 387.74 g/mol. Its IUPAC name is 2,2-dichloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2,2-dichloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 4020577 |
| Molecular Formula | C18H21Cl3N2O |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2,2-dichloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(Cc1cccn1Cc1ccccc1Cl)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C18H21Cl3N2O/c1-13(2)10-23(18(24)17(20)21)12-15-7-5-9-22(15)11-14-6-3-4-8-16(14)19/h3-9,13,17H,10-12H2,1-2H3 |
| InChIKey | XAOSENWHUNVFQX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|