C28H42ClN3O2 — CID 3278411
N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-2-oxoethyl]-N-ethyloctanamide (PubChem CID 3278411) has the molecular formula C28H42ClN3O2 and a molecular weight of 488.12 g/mol. Its IUPAC name is N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-2-oxoethyl]-N-ethyloctanamide.
| Compound Name | N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-2-oxoethyl]-N-ethyloctanamide |
|---|---|
| PubChem CID | 3278411 |
| Molecular Formula | C28H42ClN3O2 |
| Molecular Weight | 488.12 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-2-oxoethyl]-N-ethyloctanamide |
| SMILES | CCCCCCCC(=O)N(CC)CC(=O)N(Cc1cccn1Cc1ccccc1Cl)CC(C)C |
| InChI | InChI=1S/C28H42ClN3O2/c1-5-7-8-9-10-17-27(33)30(6-2)22-28(34)32(19-23(3)4)21-25-15-13-18-31(25)20-24-14-11-12-16-26(24)29/h11-16,18,23H,5-10,17,19-22H2,1-4H3 |
| InChIKey | JLGPNBKRZCJKIG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.12 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|