C19H23ClN2O — CID 42764244
N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylcyclopropanecarboxamide (PubChem CID 42764244) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylcyclopropanecarboxamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 42764244 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylcyclopropanecarboxamide |
| SMILES | CCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)C1CC1 |
| InChI | InChI=1S/C19H23ClN2O/c1-2-11-22(19(23)15-9-10-15)14-17-7-5-12-21(17)13-16-6-3-4-8-18(16)20/h3-8,12,15H,2,9-11,13-14H2,1H3 |
| InChIKey | PBYOWZIFWPOWFR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |