C32H38ClN3O2 — CID 6115342
(E)-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide (PubChem CID 6115342) has the molecular formula C32H38ClN3O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is (E)-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide.
| Compound Name | (E)-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 6115342 |
| Molecular Formula | C32H38ClN3O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (E)-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide |
| SMILES | CCCN(CC(=O)N(Cc1cccn1Cc1ccccc1Cl)C1CCCCC1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H38ClN3O2/c1-2-21-35(31(37)20-19-26-12-5-3-6-13-26)25-32(38)36(28-15-7-4-8-16-28)24-29-17-11-22-34(29)23-27-14-9-10-18-30(27)33/h3,5-6,9-14,17-20,22,28H,2,4,7-8,15-16,21,23-25H2,1H3/b20-19+ |
| InChIKey | GHZIOMNHISRCFL-FMQUCBEESA-N |
| XLogP | 6.80 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|