C17H25ClN2O6 — CID 174433828
[3-[(2-chlorophenoxy)methyl-hydroxyamino]-2,2-dimethyl-3-oxopropyl] acetate;propanamide (PubChem CID 174433828) has the molecular formula C17H25ClN2O6 and a molecular weight of 388.85 g/mol. Its IUPAC name is [3-[(2-chlorophenoxy)methyl-hydroxyamino]-2,2-dimethyl-3-oxopropyl] acetate;propanamide.
| Compound Name | [3-[(2-chlorophenoxy)methyl-hydroxyamino]-2,2-dimethyl-3-oxopropyl] acetate;propanamide |
|---|---|
| PubChem CID | 174433828 |
| Molecular Formula | C17H25ClN2O6 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [3-[(2-chlorophenoxy)methyl-hydroxyamino]-2,2-dimethyl-3-oxopropyl] acetate;propanamide |
| SMILES | CC(=O)OCC(C)(C)C(=O)N(O)COc1ccccc1Cl.CCC(N)=O |
| InChI | InChI=1S/C14H18ClNO5.C3H7NO/c1-10(17)20-8-14(2,3)13(18)16(19)9-21-12-7-5-4-6-11(12)15;1-2-3(4)5/h4-7,19H,8-9H2,1-3H3;2H2,1H3,(H2,4,5) |
| InChIKey | RISAVNZNNOURLN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|