C11H12ClFO2 — CID 82041206
3-(4-fluorophenoxy)-2,2-dimethylpropanoyl chloride (PubChem CID 82041206) has the molecular formula C11H12ClFO2 and a molecular weight of 230.67 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-2,2-dimethylpropanoyl chloride.
| Compound Name | 3-(4-fluorophenoxy)-2,2-dimethylpropanoyl chloride |
|---|---|
| PubChem CID | 82041206 |
| Molecular Formula | C11H12ClFO2 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-(4-fluorophenoxy)-2,2-dimethylpropanoyl chloride |
| SMILES | CC(C)(COc1ccc(F)cc1)C(=O)Cl |
| InChI | InChI=1S/C11H12ClFO2/c1-11(2,10(12)14)7-15-9-5-3-8(13)4-6-9/h3-6H,7H2,1-2H3 |
| InChIKey | PXZDHJKAFUZPDV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|