C12H16O4 — CID 87112604
4-(2,2-dimethylpropoxy)benzenecarboperoxoic acid (PubChem CID 87112604) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxy)benzenecarboperoxoic acid.
| Compound Name | 4-(2,2-dimethylpropoxy)benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 87112604 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(2,2-dimethylpropoxy)benzenecarboperoxoic acid |
| SMILES | CC(C)(C)COc1ccc(C(=O)OO)cc1 |
| InChI | InChI=1S/C12H16O4/c1-12(2,3)8-15-10-6-4-9(5-7-10)11(13)16-14/h4-7,14H,8H2,1-3H3 |
| InChIKey | MMNNTWRRCBYZQL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|