C21H22O8 — CID 67409597
4-(2,2-dimethylpropoxycarbonyl)benzoic acid;terephthalic acid (PubChem CID 67409597) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxycarbonyl)benzoic acid;terephthalic acid.
| Compound Name | 4-(2,2-dimethylpropoxycarbonyl)benzoic acid;terephthalic acid |
|---|---|
| PubChem CID | 67409597 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-(2,2-dimethylpropoxycarbonyl)benzoic acid;terephthalic acid |
| SMILES | CC(C)(C)COC(=O)c1ccc(C(=O)O)cc1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H16O4.C8H6O4/c1-13(2,3)8-17-12(16)10-6-4-9(5-7-10)11(14)15;9-7(10)5-1-2-6(4-3-5)8(11)12/h4-7H,8H2,1-3H3,(H,14,15);1-4H,(H,9,10)(H,11,12) |
| InChIKey | GNDOCAYKCLFGGU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |