C19H30O6 — CID 69129332
3-(2,2-dimethylpropoxycarbonyl)benzoic acid;hexane-1,6-diol (PubChem CID 69129332) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(2,2-dimethylpropoxycarbonyl)benzoic acid;hexane-1,6-diol.
| Compound Name | 3-(2,2-dimethylpropoxycarbonyl)benzoic acid;hexane-1,6-diol |
|---|---|
| PubChem CID | 69129332 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3-(2,2-dimethylpropoxycarbonyl)benzoic acid;hexane-1,6-diol |
| SMILES | CC(C)(C)COC(=O)c1cccc(C(=O)O)c1.OCCCCCCO |
| InChI | InChI=1S/C13H16O4.C6H14O2/c1-13(2,3)8-17-12(16)10-6-4-5-9(7-10)11(14)15;7-5-3-1-2-4-6-8/h4-7H,8H2,1-3H3,(H,14,15);7-8H,1-6H2 |
| InChIKey | SZGJBLLTJBKSNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|