C18H26O7S — CID 22263417
3,5-bis(2,2-dimethylpropoxycarbonyl)benzenesulfonic acid (PubChem CID 22263417) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3,5-bis(2,2-dimethylpropoxycarbonyl)benzenesulfonic acid.
| Compound Name | 3,5-bis(2,2-dimethylpropoxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 22263417 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3,5-bis(2,2-dimethylpropoxycarbonyl)benzenesulfonic acid |
| SMILES | CC(C)(C)COC(=O)c1cc(C(=O)OCC(C)(C)C)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H26O7S/c1-17(2,3)10-24-15(19)12-7-13(9-14(8-12)26(21,22)23)16(20)25-11-18(4,5)6/h7-9H,10-11H2,1-6H3,(H,21,22,23) |
| InChIKey | RKIRYECMLHNTID-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|