C15H16O7S — CID 175022362
3-hepta-2,4-dienoxycarbonyl-5-sulfobenzoic acid (PubChem CID 175022362) has the molecular formula C15H16O7S and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-hepta-2,4-dienoxycarbonyl-5-sulfobenzoic acid.
| Compound Name | 3-hepta-2,4-dienoxycarbonyl-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 175022362 |
| Molecular Formula | C15H16O7S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3-hepta-2,4-dienoxycarbonyl-5-sulfobenzoic acid |
| SMILES | CCC=CC=CCOC(=O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H16O7S/c1-2-3-4-5-6-7-22-15(18)12-8-11(14(16)17)9-13(10-12)23(19,20)21/h3-6,8-10H,2,7H2,1H3,(H,16,17)(H,19,20,21) |
| InChIKey | YTJMFYVUACDVEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|