C12H14KO7S+ — CID 23355943
potassium 3,5-bis(ethoxycarbonyl)benzenesulfonic acid (PubChem CID 23355943) has the molecular formula C12H14KO7S+ and a molecular weight of 341.40 g/mol. Its IUPAC name is potassium 3,5-bis(ethoxycarbonyl)benzenesulfonic acid.
| Compound Name | potassium 3,5-bis(ethoxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 23355943 |
| Molecular Formula | C12H14KO7S+ |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | potassium 3,5-bis(ethoxycarbonyl)benzenesulfonic acid |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)cc(S(=O)(=O)O)c1.[K+] |
| InChI | InChI=1S/C12H14O7S.K/c1-3-18-11(13)8-5-9(12(14)19-4-2)7-10(6-8)20(15,16)17;/h5-7H,3-4H2,1-2H3,(H,15,16,17);/q;+1 |
| InChIKey | XWXDGNYEEWSXID-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|