C11H14ClFN2O2 — CID 79627308
3-(3-chloro-4-fluorophenoxy)-2,2-dimethylpropanehydrazide (PubChem CID 79627308) has the molecular formula C11H14ClFN2O2 and a molecular weight of 260.70 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenoxy)-2,2-dimethylpropanehydrazide.
| Compound Name | 3-(3-chloro-4-fluorophenoxy)-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79627308 |
| Molecular Formula | C11H14ClFN2O2 |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(3-chloro-4-fluorophenoxy)-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(COc1ccc(F)c(Cl)c1)C(=O)NN |
| InChI | InChI=1S/C11H14ClFN2O2/c1-11(2,10(16)15-14)6-17-7-3-4-9(13)8(12)5-7/h3-5H,6,14H2,1-2H3,(H,15,16) |
| InChIKey | HPMOXRUEFFLNOE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|