C34H32Cl2F2N4O10 — CID 87877442
3-(3-chloro-4-fluorophenoxy)-2-hydroxy-2-methyl-N-(2-methyl-3-nitrophenyl)propanamide (PubChem CID 87877442) has the molecular formula C34H32Cl2F2N4O10 and a molecular weight of 765.55 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenoxy)-2-hydroxy-2-methyl-N-(2-methyl-3-nitrophenyl)propanamide.
| Compound Name | 3-(3-chloro-4-fluorophenoxy)-2-hydroxy-2-methyl-N-(2-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 87877442 |
| Molecular Formula | C34H32Cl2F2N4O10 |
| Molecular Weight | 765.55 g/mol |
| Exact Mass | 764.15 |
| IUPAC Name | 3-(3-chloro-4-fluorophenoxy)-2-hydroxy-2-methyl-N-(2-methyl-3-nitrophenyl)propanamide |
| SMILES | Cc1c(NC(=O)C(C)(O)COc2ccc(F)c(Cl)c2)cccc1[N+](=O)[O-].Cc1c(NC(=O)C(C)(O)COc2ccc(F)c(Cl)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C17H16ClFN2O5/c2*1-10-14(4-3-5-15(10)21(24)25)20-16(22)17(2,23)9-26-11-6-7-13(19)12(18)8-11/h2*3-8,23H,9H2,1-2H3,(H,20,22) |
| InChIKey | DMZMITNTXDZKAR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|