C12H14F2O3 — CID 79622618
methyl 3-(3,4-difluorophenoxy)-2,2-dimethylpropanoate (PubChem CID 79622618) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl 3-(3,4-difluorophenoxy)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(3,4-difluorophenoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79622618 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl 3-(3,4-difluorophenoxy)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O3/c1-12(2,11(15)16-3)7-17-8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3 |
| InChIKey | KVFPHFMESAUKLC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |