C13H15NO3 — CID 79622779
methyl 3-(3-cyanophenoxy)-2,2-dimethylpropanoate (PubChem CID 79622779) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 3-(3-cyanophenoxy)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(3-cyanophenoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79622779 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl 3-(3-cyanophenoxy)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H15NO3/c1-13(2,12(15)16-3)9-17-11-6-4-5-10(7-11)8-14/h4-7H,9H2,1-3H3 |
| InChIKey | RJAYECBJYUTKOO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |