C19H16N2O6 — CID 2591381
dimethyl 5-[[2-(3-cyanophenoxy)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 2591381) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is dimethyl 5-[[2-(3-cyanophenoxy)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(3-cyanophenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2591381 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | dimethyl 5-[[2-(3-cyanophenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COc2cccc(C#N)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H16N2O6/c1-25-18(23)13-7-14(19(24)26-2)9-15(8-13)21-17(22)11-27-16-5-3-4-12(6-16)10-20/h3-9H,11H2,1-2H3,(H,21,22) |
| InChIKey | MLVLRSPQMUWCKO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |