C17H16N2O4 — CID 7713816
N-(3-cyanophenyl)-2-(3,5-dimethoxyphenoxy)acetamide (PubChem CID 7713816) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(3,5-dimethoxyphenoxy)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(3,5-dimethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7713816 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(3-cyanophenyl)-2-(3,5-dimethoxyphenoxy)acetamide |
| SMILES | COc1cc(OC)cc(OCC(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-21-14-7-15(22-2)9-16(8-14)23-11-17(20)19-13-5-3-4-12(6-13)10-18/h3-9H,11H2,1-2H3,(H,19,20) |
| InChIKey | JIFHOTCUKFUUQA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |