C19H32O — CID 164583804
2,4,4,6,6-pentamethylheptan-2-yloxymethylbenzene (PubChem CID 164583804) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 2,4,4,6,6-pentamethylheptan-2-yloxymethylbenzene.
| Compound Name | 2,4,4,6,6-pentamethylheptan-2-yloxymethylbenzene |
|---|---|
| PubChem CID | 164583804 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 2,4,4,6,6-pentamethylheptan-2-yloxymethylbenzene |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)OCc1ccccc1 |
| InChI | InChI=1S/C19H32O/c1-17(2,3)14-18(4,5)15-19(6,7)20-13-16-11-9-8-10-12-16/h8-12H,13-15H2,1-7H3 |
| InChIKey | OZNIZUNZMDJHJF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |