C16H26O — CID 123305221
2,4,4-trimethylhexan-2-yloxymethylbenzene (PubChem CID 123305221) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2,4,4-trimethylhexan-2-yloxymethylbenzene.
| Compound Name | 2,4,4-trimethylhexan-2-yloxymethylbenzene |
|---|---|
| PubChem CID | 123305221 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2,4,4-trimethylhexan-2-yloxymethylbenzene |
| SMILES | CCC(C)(C)CC(C)(C)OCc1ccccc1 |
| InChI | InChI=1S/C16H26O/c1-6-15(2,3)13-16(4,5)17-12-14-10-8-7-9-11-14/h7-11H,6,12-13H2,1-5H3 |
| InChIKey | VSRARBVTNOFOIA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |