C15H25O2P — CID 143149832
phenylmethoxy(2,4,4-trimethylpentan-2-yl)phosphinous acid (PubChem CID 143149832) has the molecular formula C15H25O2P and a molecular weight of 268.34 g/mol. Its IUPAC name is phenylmethoxy(2,4,4-trimethylpentan-2-yl)phosphinous acid.
| Compound Name | phenylmethoxy(2,4,4-trimethylpentan-2-yl)phosphinous acid |
|---|---|
| PubChem CID | 143149832 |
| Molecular Formula | C15H25O2P |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | phenylmethoxy(2,4,4-trimethylpentan-2-yl)phosphinous acid |
| SMILES | CC(C)(C)CC(C)(C)P(O)OCc1ccccc1 |
| InChI | InChI=1S/C15H25O2P/c1-14(2,3)12-15(4,5)18(16)17-11-13-9-7-6-8-10-13/h6-10,16H,11-12H2,1-5H3 |
| InChIKey | CKQWSKXVGXTUFV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|