C26H34O2 — CID 160642303
[(1E)-1-(2,2-dimethylpropylidene)-4,4-dimethyl-2-phenylmethoxypent-2-enoxy]methylbenzene (PubChem CID 160642303) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is [(1E)-1-(2,2-dimethylpropylidene)-4,4-dimethyl-2-phenylmethoxypent-2-enoxy]methylbenzene.
| Compound Name | [(1E)-1-(2,2-dimethylpropylidene)-4,4-dimethyl-2-phenylmethoxypent-2-enoxy]methylbenzene |
|---|---|
| PubChem CID | 160642303 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | [(1E)-1-(2,2-dimethylpropylidene)-4,4-dimethyl-2-phenylmethoxypent-2-enoxy]methylbenzene |
| SMILES | CC(C)(C)C=C(OCc1ccccc1)/C(=C\C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C26H34O2/c1-25(2,3)17-23(27-19-21-13-9-7-10-14-21)24(18-26(4,5)6)28-20-22-15-11-8-12-16-22/h7-18H,19-20H2,1-6H3/b23-17+,24-18? |
| InChIKey | UQMLRLRDHNYBDE-AALPEOGESA-N |
| XLogP | 7.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|