C19H20O2 — CID 134286025
[(3E)-2-phenylmethoxypenta-1,3-dien-3-yl]oxymethylbenzene (PubChem CID 134286025) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [(3E)-2-phenylmethoxypenta-1,3-dien-3-yl]oxymethylbenzene.
| Compound Name | [(3E)-2-phenylmethoxypenta-1,3-dien-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 134286025 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(3E)-2-phenylmethoxypenta-1,3-dien-3-yl]oxymethylbenzene |
| SMILES | C=C(OCc1ccccc1)/C(=C\C)OCc1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-3-19(21-15-18-12-8-5-9-13-18)16(2)20-14-17-10-6-4-7-11-17/h3-13H,2,14-15H2,1H3/b19-3+ |
| InChIKey | JKQYTTFPMYIQSM-QBROUFQSSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|