C16H20O — CID 145085704
[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]oxymethylbenzene (PubChem CID 145085704) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is [(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]oxymethylbenzene.
| Compound Name | [(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 145085704 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]oxymethylbenzene |
| SMILES | C=C(C)/C=C(\C=C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-13(2)10-16(11-14(3)4)17-12-15-8-6-5-7-9-15/h5-11H,1,12H2,2-4H3/b16-10+ |
| InChIKey | DHJDRFHAIVPSTH-MHWRWJLKSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|