About ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine
ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine (PubChem CID 143914934) has the molecular formula C18H27NO4
and a molecular weight of 321.42 g/mol. Its IUPAC name is ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine.
Molecular Properties
| Compound Name | ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine |
| PubChem CID | 143914934 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine |
| SMILES | C=C(C)N.CC.CCOC(=O)/C=C(/C=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H14O4.C3H7N.C2H6/c1-2-16-13(15)8-12(9-14)17-10-11-6-4-3-5-7-11;1-3(2)4;1-2/h3-9H,2,10H2,1H3;1,4H2,2H3;1-2H3/b12-8-;; |
| InChIKey | FBHUXSCRPBJDHC-ARWCDVPCSA-N |
| XLogP | 3.35 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine?
The IUPAC name of ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine (CID 143914934) is ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine.
What is the SMILES notation for ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine?
The canonical SMILES for ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine is C=C(C)N.CC.CCOC(=O)/C=C(/C=O)OCc1ccccc1.
What is the InChIKey of ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine?
The InChIKey is FBHUXSCRPBJDHC-ARWCDVPCSA-N. The full InChI is InChI=1S/C13H14O4.C3H7N.C2H6/c1-2-16-13(15)8-12(9-14)17-10-11-6-4-3-5-7-11;1-3(2)4;1-2/h3-9H,2,10H2,1H3;1,4H2,2H3;1-2H3/b12-8-;;.
What are the key properties of ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine?
ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine has a molecular weight of 321.42 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl (Z)-4-oxo-3-phenylmethoxybut-2-enoate;prop-1-en-2-amine is sourced from PubChem (CID 143914934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).