C30H29NO2 — CID 174883797
1,1-diphenylethylbenzene;2-phenylmethoxyprop-2-enamide (PubChem CID 174883797) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1,1-diphenylethylbenzene;2-phenylmethoxyprop-2-enamide.
| Compound Name | 1,1-diphenylethylbenzene;2-phenylmethoxyprop-2-enamide |
|---|---|
| PubChem CID | 174883797 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1,1-diphenylethylbenzene;2-phenylmethoxyprop-2-enamide |
| SMILES | C=C(OCc1ccccc1)C(N)=O.CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18.C10H11NO2/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-16H,1H3;2-6H,1,7H2,(H2,11,12) |
| InChIKey | QQWZGXBIMBHAAY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|