C23H23NO — CID 174910563
1,1-diphenylethylbenzene;prop-2-enamide (PubChem CID 174910563) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 1,1-diphenylethylbenzene;prop-2-enamide.
| Compound Name | 1,1-diphenylethylbenzene;prop-2-enamide |
|---|---|
| PubChem CID | 174910563 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1,1-diphenylethylbenzene;prop-2-enamide |
| SMILES | C=CC(N)=O.CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18.C3H5NO/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-2-3(4)5/h2-16H,1H3;2H,1H2,(H2,4,5) |
| InChIKey | XVWQJQOLHZPSEJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|