C20H20N2O2 — CID 118555479
4,5-diamino-4,5-diphenylocta-1,7-diene-3,6-dione (PubChem CID 118555479) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4,5-diamino-4,5-diphenylocta-1,7-diene-3,6-dione.
| Compound Name | 4,5-diamino-4,5-diphenylocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 118555479 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4,5-diamino-4,5-diphenylocta-1,7-diene-3,6-dione |
| SMILES | C=CC(=O)C(N)(c1ccccc1)C(N)(C(=O)C=C)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-17(23)19(21,15-11-7-5-8-12-15)20(22,18(24)4-2)16-13-9-6-10-14-16/h3-14H,1-2,21-22H2 |
| InChIKey | OTVGTLBPHZQFBO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|