C11H13NO2 — CID 70119036
3-amino-3-phenylpentane-2,4-dione (PubChem CID 70119036) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-amino-3-phenylpentane-2,4-dione.
| Compound Name | 3-amino-3-phenylpentane-2,4-dione |
|---|---|
| PubChem CID | 70119036 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-amino-3-phenylpentane-2,4-dione |
| SMILES | CC(=O)C(N)(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-8(13)11(12,9(2)14)10-6-4-3-5-7-10/h3-7H,12H2,1-2H3 |
| InChIKey | NGPNQGIWWSQPBT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|