C18H16O3 — CID 140640307
4,4-diphenylhexane-2,3,5-trione (PubChem CID 140640307) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4,4-diphenylhexane-2,3,5-trione.
| Compound Name | 4,4-diphenylhexane-2,3,5-trione |
|---|---|
| PubChem CID | 140640307 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4,4-diphenylhexane-2,3,5-trione |
| SMILES | CC(=O)C(=O)C(C(C)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16O3/c1-13(19)17(21)18(14(2)20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | HZQYEZSOKZCKLO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|