C16H15O2- — CID 101443170
3-oxo-1,1-diphenylbutan-1-olate (PubChem CID 101443170) has the molecular formula C16H15O2- and a molecular weight of 239.29 g/mol. Its IUPAC name is 3-oxo-1,1-diphenylbutan-1-olate.
| Compound Name | 3-oxo-1,1-diphenylbutan-1-olate |
|---|---|
| PubChem CID | 101443170 |
| Molecular Formula | C16H15O2- |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-oxo-1,1-diphenylbutan-1-olate |
| SMILES | CC(=O)CC([O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15O2/c1-13(17)12-16(18,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11H,12H2,1H3/q-1 |
| InChIKey | CRAPONXNNQYVJG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |