About 4-amino-4-methylpentan-2-one;benzoic acid
4-amino-4-methylpentan-2-one;benzoic acid (PubChem CID 174476286) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-amino-4-methylpentan-2-one;benzoic acid.
Molecular Properties
| Compound Name | 4-amino-4-methylpentan-2-one;benzoic acid |
| PubChem CID | 174476286 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-amino-4-methylpentan-2-one;benzoic acid |
| SMILES | CC(=O)CC(C)(C)N.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H13NO/c8-7(9)6-4-2-1-3-5-6;1-5(8)4-6(2,3)7/h1-5H,(H,8,9);4,7H2,1-3H3 |
| InChIKey | UBFMYXDXOJUEJR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-4-methylpentan-2-one;benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-methylpentan-2-one;benzoic acid?
The IUPAC name of 4-amino-4-methylpentan-2-one;benzoic acid (CID 174476286) is 4-amino-4-methylpentan-2-one;benzoic acid.
What is the SMILES notation for 4-amino-4-methylpentan-2-one;benzoic acid?
The canonical SMILES for 4-amino-4-methylpentan-2-one;benzoic acid is CC(=O)CC(C)(C)N.O=C(O)c1ccccc1.
What is the InChIKey of 4-amino-4-methylpentan-2-one;benzoic acid?
The InChIKey is UBFMYXDXOJUEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H13NO/c8-7(9)6-4-2-1-3-5-6;1-5(8)4-6(2,3)7/h1-5H,(H,8,9);4,7H2,1-3H3.
What are the key properties of 4-amino-4-methylpentan-2-one;benzoic acid?
4-amino-4-methylpentan-2-one;benzoic acid has a molecular weight of 237.30 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-methylpentan-2-one;benzoic acid is sourced from PubChem (CID 174476286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).