C16H17NO2Si — CID 152663571
1-[amino(ethenyl)silyl]-2-hydroxy-2,2-diphenylethanone (PubChem CID 152663571) has the molecular formula C16H17NO2Si and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-[amino(ethenyl)silyl]-2-hydroxy-2,2-diphenylethanone.
| Compound Name | 1-[amino(ethenyl)silyl]-2-hydroxy-2,2-diphenylethanone |
|---|---|
| PubChem CID | 152663571 |
| Molecular Formula | C16H17NO2Si |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[amino(ethenyl)silyl]-2-hydroxy-2,2-diphenylethanone |
| SMILES | C=C[SiH](N)C(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2Si/c1-2-20(17)15(18)16(19,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12,19-20H,1,17H2 |
| InChIKey | ZKBCKIWHWHLXTF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|